C10H10F5NS — CID 172706269
4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutan-1-amine (PubChem CID 172706269) has the molecular formula C10H10F5NS and a molecular weight of 271.25 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutan-1-amine.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutan-1-amine |
|---|---|
| PubChem CID | 172706269 |
| Molecular Formula | C10H10F5NS |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)sulfanylbutan-1-amine |
| SMILES | NCCCCSc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5NS/c11-5-6(12)8(14)10(9(15)7(5)13)17-4-2-1-3-16/h1-4,16H2 |
| InChIKey | DQBCYJVLIWCACB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|