About 2-cyclopenta-1,3-dien-1-ylguanidine
2-cyclopenta-1,3-dien-1-ylguanidine (PubChem CID 172707199) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-ylguanidine.
Molecular Properties
| Compound Name | 2-cyclopenta-1,3-dien-1-ylguanidine |
| PubChem CID | 172707199 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-ylguanidine |
| SMILES | NC(N)=NC1=CC=CC1 |
| InChI | InChI=1S/C6H9N3/c7-6(8)9-5-3-1-2-4-5/h1-3H,4H2,(H4,7,8,9) |
| InChIKey | NVJFWSYDEDODQZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-1,3-dien-1-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,3-dien-1-ylguanidine?
The IUPAC name of 2-cyclopenta-1,3-dien-1-ylguanidine (CID 172707199) is 2-cyclopenta-1,3-dien-1-ylguanidine.
What is the SMILES notation for 2-cyclopenta-1,3-dien-1-ylguanidine?
The canonical SMILES for 2-cyclopenta-1,3-dien-1-ylguanidine is NC(N)=NC1=CC=CC1.
What is the InChIKey of 2-cyclopenta-1,3-dien-1-ylguanidine?
The InChIKey is NVJFWSYDEDODQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c7-6(8)9-5-3-1-2-4-5/h1-3H,4H2,(H4,7,8,9).
What are the key properties of 2-cyclopenta-1,3-dien-1-ylguanidine?
2-cyclopenta-1,3-dien-1-ylguanidine has a molecular weight of 123.16 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,3-dien-1-ylguanidine is sourced from PubChem (CID 172707199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).