C24H25F3N8O2 — CID 172707216
(2S)-1-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one (PubChem CID 172707216) has the molecular formula C24H25F3N8O2 and a molecular weight of 514.51 g/mol. Its IUPAC name is (2S)-1-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one.
| Compound Name | (2S)-1-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 172707216 |
| Molecular Formula | C24H25F3N8O2 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (2S)-1-[4-[4-amino-5-(5-methyl-1H-pyrazol-3-yl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]-3,3,3-trifluoro-2-methoxy-2-phenylpropan-1-one |
| SMILES | CO[C@](C(=O)N1CCN(c2nc(N)c3c(-c4cc(C)[nH]n4)ccn3n2)CC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H25F3N8O2/c1-15-14-18(31-30-15)17-8-9-35-19(17)20(28)29-22(32-35)34-12-10-33(11-13-34)21(36)23(37-2,24(25,26)27)16-6-4-3-5-7-16/h3-9,14H,10-13H2,1-2H3,(H,30,31)(H2,28,29,32)/t23-/m0/s1 |
| InChIKey | DTDMTIRBGCOKRX-QHCPKHFHSA-N |
| XLogP | 2.76 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |