About diazanium;3-(diethylamino)propan-1-ol;sulfate
diazanium;3-(diethylamino)propan-1-ol;sulfate (PubChem CID 172707581) has the molecular formula C7H25N3O5S
and a molecular weight of 263.36 g/mol. Its IUPAC name is diazanium;3-(diethylamino)propan-1-ol;sulfate.
Molecular Properties
| Compound Name | diazanium;3-(diethylamino)propan-1-ol;sulfate |
| PubChem CID | 172707581 |
| Molecular Formula | C7H25N3O5S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | diazanium;3-(diethylamino)propan-1-ol;sulfate |
| SMILES | CCN(CC)CCCO.O=S(=O)([O-])[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/C7H17NO.2H3N.H2O4S/c1-3-8(4-2)6-5-7-9;;;1-5(2,3)4/h9H,3-7H2,1-2H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | DULMNRGHUDIYIQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 176.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze diazanium;3-(diethylamino)propan-1-ol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;3-(diethylamino)propan-1-ol;sulfate?
The IUPAC name of diazanium;3-(diethylamino)propan-1-ol;sulfate (CID 172707581) is diazanium;3-(diethylamino)propan-1-ol;sulfate.
What is the SMILES notation for diazanium;3-(diethylamino)propan-1-ol;sulfate?
The canonical SMILES for diazanium;3-(diethylamino)propan-1-ol;sulfate is CCN(CC)CCCO.O=S(=O)([O-])[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;3-(diethylamino)propan-1-ol;sulfate?
The InChIKey is DULMNRGHUDIYIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO.2H3N.H2O4S/c1-3-8(4-2)6-5-7-9;;;1-5(2,3)4/h9H,3-7H2,1-2H3;2*1H3;(H2,1,2,3,4).
What are the key properties of diazanium;3-(diethylamino)propan-1-ol;sulfate?
diazanium;3-(diethylamino)propan-1-ol;sulfate has a molecular weight of 263.36 g/mol, XLogP of 0.12, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;3-(diethylamino)propan-1-ol;sulfate is sourced from PubChem (CID 172707581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).