About CID 172708990
CID 172708990 (PubChem CID 172708990) has the molecular formula C4H7KNO4S
and a molecular weight of 204.27 g/mol.
Molecular Properties
| Compound Name | CID 172708990 |
| PubChem CID | 172708990 |
| Molecular Formula | C4H7KNO4S |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NCS(=O)(=O)O.[K] |
| InChI | InChI=1S/C4H7NO4S.K/c1-2-4(6)5-3-10(7,8)9;/h2H,1,3H2,(H,5,6)(H,7,8,9); |
| InChIKey | DZHNPFVTFSECAA-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 172708990 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172708990?
The IUPAC name of CID 172708990 (CID 172708990) is not available.
What is the SMILES notation for CID 172708990?
The canonical SMILES for CID 172708990 is C=CC(=O)NCS(=O)(=O)O.[K].
What is the InChIKey of CID 172708990?
The InChIKey is DZHNPFVTFSECAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO4S.K/c1-2-4(6)5-3-10(7,8)9;/h2H,1,3H2,(H,5,6)(H,7,8,9);.
What are the key properties of CID 172708990?
CID 172708990 has a molecular weight of 204.27 g/mol, XLogP of -1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172708990 is sourced from PubChem (CID 172708990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).