C18H19N3O4Si — CID 172709352
3-(4-methyl-3-nitrophenyl)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid (PubChem CID 172709352) has the molecular formula C18H19N3O4Si and a molecular weight of 369.45 g/mol. Its IUPAC name is 3-(4-methyl-3-nitrophenyl)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 3-(4-methyl-3-nitrophenyl)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 172709352 |
| Molecular Formula | C18H19N3O4Si |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-(4-methyl-3-nitrophenyl)-2-trimethylsilyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| SMILES | Cc1ccc(-c2c([Si](C)(C)C)[nH]c3ncc(C(=O)O)cc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O4Si/c1-10-5-6-11(8-14(10)21(24)25)15-13-7-12(18(22)23)9-19-16(13)20-17(15)26(2,3)4/h5-9H,1-4H3,(H,19,20)(H,22,23) |
| InChIKey | FANSDPQSJZBFLN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|