C23H27ClN4O4S — CID 17270943
2-[[5-(4-butoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-2,5-dimethoxyphenyl)acetamide (PubChem CID 17270943) has the molecular formula C23H27ClN4O4S and a molecular weight of 491.01 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[5-(4-butoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17270943 |
| Molecular Formula | C23H27ClN4O4S |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-2,5-dimethoxyphenyl)acetamide |
| SMILES | CCCCOc1ccc(-c2nnc(SCC(=O)Nc3cc(OC)c(Cl)cc3OC)n2C)cc1 |
| InChI | InChI=1S/C23H27ClN4O4S/c1-5-6-11-32-16-9-7-15(8-10-16)22-26-27-23(28(22)2)33-14-21(29)25-18-13-19(30-3)17(24)12-20(18)31-4/h7-10,12-13H,5-6,11,14H2,1-4H3,(H,25,29) |
| InChIKey | JVIIROYFXLUUOC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|