C20H18Cl2N4O2S — CID 17271108
2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)acetamide (PubChem CID 17271108) has the molecular formula C20H18Cl2N4O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 17271108 |
| Molecular Formula | C20H18Cl2N4O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Cl)cc2)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C20H18Cl2N4O2S/c1-3-10-26-19(16-11-14(22)6-9-17(16)28-2)24-25-20(26)29-12-18(27)23-15-7-4-13(21)5-8-15/h3-9,11H,1,10,12H2,2H3,(H,23,27) |
| InChIKey | YAYNEPOCAFXDGL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|