C16H20N3S2+ — CID 172711663
1-ethylsulfanyl-3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-phenyl-1,2,5-thiadiazol-1-ium (PubChem CID 172711663) has the molecular formula C16H20N3S2+ and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-ethylsulfanyl-3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-phenyl-1,2,5-thiadiazol-1-ium.
| Compound Name | 1-ethylsulfanyl-3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-phenyl-1,2,5-thiadiazol-1-ium |
|---|---|
| PubChem CID | 172711663 |
| Molecular Formula | C16H20N3S2+ |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-ethylsulfanyl-3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-phenyl-1,2,5-thiadiazol-1-ium |
| SMILES | CCS[s+]1nc(C2=CCCN(C)C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H20N3S2/c1-3-20-21-17-15(13-8-5-4-6-9-13)16(18-21)14-10-7-11-19(2)12-14/h4-6,8-10H,3,7,11-12H2,1-2H3/q+1 |
| InChIKey | FIEIKQUFNMBGPF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|