C33H40F2N6O3 — CID 172711886
N-[5-[1-(3,5-difluorophenyl)propan-2-yl]indazol-1-yl]-3-[3-(methoxymethoxy)propylamino]-2-(4-methylpiperazin-1-yl)benzamide (PubChem CID 172711886) has the molecular formula C33H40F2N6O3 and a molecular weight of 606.72 g/mol. Its IUPAC name is N-[5-[1-(3,5-difluorophenyl)propan-2-yl]indazol-1-yl]-3-[3-(methoxymethoxy)propylamino]-2-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[1-(3,5-difluorophenyl)propan-2-yl]indazol-1-yl]-3-[3-(methoxymethoxy)propylamino]-2-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 172711886 |
| Molecular Formula | C33H40F2N6O3 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | N-[5-[1-(3,5-difluorophenyl)propan-2-yl]indazol-1-yl]-3-[3-(methoxymethoxy)propylamino]-2-(4-methylpiperazin-1-yl)benzamide |
| SMILES | COCOCCCNc1cccc(C(=O)Nn2ncc3cc(C(C)Cc4cc(F)cc(F)c4)ccc32)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C33H40F2N6O3/c1-23(16-24-17-27(34)20-28(35)18-24)25-8-9-31-26(19-25)21-37-41(31)38-33(42)29-6-4-7-30(36-10-5-15-44-22-43-3)32(29)40-13-11-39(2)12-14-40/h4,6-9,17-21,23,36H,5,10-16,22H2,1-3H3,(H,38,42) |
| InChIKey | FIYFBQVIVKDWOJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|