About 1-bromopentane;4-pyridin-4-ylpyridine
1-bromopentane;4-pyridin-4-ylpyridine (PubChem CID 172712078) has the molecular formula C15H19BrN2
and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-bromopentane;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 1-bromopentane;4-pyridin-4-ylpyridine |
| PubChem CID | 172712078 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-bromopentane;4-pyridin-4-ylpyridine |
| SMILES | CCCCCBr.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C5H11Br/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2-3-4-5-6/h1-8H;2-5H2,1H3 |
| InChIKey | FJPHADYAEJJLEP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopentane;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopentane;4-pyridin-4-ylpyridine?
The IUPAC name of 1-bromopentane;4-pyridin-4-ylpyridine (CID 172712078) is 1-bromopentane;4-pyridin-4-ylpyridine.
What is the SMILES notation for 1-bromopentane;4-pyridin-4-ylpyridine?
The canonical SMILES for 1-bromopentane;4-pyridin-4-ylpyridine is CCCCCBr.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 1-bromopentane;4-pyridin-4-ylpyridine?
The InChIKey is FJPHADYAEJJLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C5H11Br/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-2-3-4-5-6/h1-8H;2-5H2,1H3.
What are the key properties of 1-bromopentane;4-pyridin-4-ylpyridine?
1-bromopentane;4-pyridin-4-ylpyridine has a molecular weight of 307.24 g/mol, XLogP of 4.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopentane;4-pyridin-4-ylpyridine is sourced from PubChem (CID 172712078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).