About 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride
4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride (PubChem CID 172712275) has the molecular formula C13H13ClF4N2
and a molecular weight of 308.71 g/mol. Its IUPAC name is 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride |
| PubChem CID | 172712275 |
| Molecular Formula | C13H13ClF4N2 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride |
| SMILES | Cl.Nc1ccc(C2=C(F)CC(N)(C(F)(F)F)C=C2)cc1 |
| InChI | InChI=1S/C13H12F4N2.ClH/c14-11-7-12(19,13(15,16)17)6-5-10(11)8-1-3-9(18)4-2-8;/h1-6H,7,18-19H2;1H |
| InChIKey | FKEAYOMXVBGJRP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride?
The IUPAC name of 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride (CID 172712275) is 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride.
What is the SMILES notation for 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride?
The canonical SMILES for 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride is Cl.Nc1ccc(C2=C(F)CC(N)(C(F)(F)F)C=C2)cc1.
What is the InChIKey of 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride?
The InChIKey is FKEAYOMXVBGJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F4N2.ClH/c14-11-7-12(19,13(15,16)17)6-5-10(11)8-1-3-9(18)4-2-8;/h1-6H,7,18-19H2;1H.
What are the key properties of 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride?
4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride has a molecular weight of 308.71 g/mol, XLogP of 3.59, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)-5-fluoro-1-(trifluoromethyl)cyclohexa-2,4-dien-1-amine;hydrochloride is sourced from PubChem (CID 172712275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).