About N,N-dimethylmethanamine;ethanamine;hydrochloride
N,N-dimethylmethanamine;ethanamine;hydrochloride (PubChem CID 172712610) has the molecular formula C5H17ClN2
and a molecular weight of 140.66 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;ethanamine;hydrochloride |
| PubChem CID | 172712610 |
| Molecular Formula | C5H17ClN2 |
| Molecular Weight | 140.66 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | N,N-dimethylmethanamine;ethanamine;hydrochloride |
| SMILES | CCN.CN(C)C.Cl |
| InChI | InChI=1S/C3H9N.C2H7N.ClH/c1-4(2)3;1-2-3;/h1-3H3;2-3H2,1H3;1H |
| InChIKey | FLEOSGCFLJSKLN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.66 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylmethanamine;ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;ethanamine;hydrochloride?
The IUPAC name of N,N-dimethylmethanamine;ethanamine;hydrochloride (CID 172712610) is N,N-dimethylmethanamine;ethanamine;hydrochloride.
What is the SMILES notation for N,N-dimethylmethanamine;ethanamine;hydrochloride?
The canonical SMILES for N,N-dimethylmethanamine;ethanamine;hydrochloride is CCN.CN(C)C.Cl.
What is the InChIKey of N,N-dimethylmethanamine;ethanamine;hydrochloride?
The InChIKey is FLEOSGCFLJSKLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7N.ClH/c1-4(2)3;1-2-3;/h1-3H3;2-3H2,1H3;1H.
What are the key properties of N,N-dimethylmethanamine;ethanamine;hydrochloride?
N,N-dimethylmethanamine;ethanamine;hydrochloride has a molecular weight of 140.66 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;ethanamine;hydrochloride is sourced from PubChem (CID 172712610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).