About 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol
2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol (PubChem CID 17271274) has the molecular formula C16H16N2OS
and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol |
| PubChem CID | 17271274 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol |
| SMILES | Cc1cc(C)c2nc(NCc3ccccc3O)sc2c1 |
| InChI | InChI=1S/C16H16N2OS/c1-10-7-11(2)15-14(8-10)20-16(18-15)17-9-12-5-3-4-6-13(12)19/h3-8,19H,9H2,1-2H3,(H,17,18) |
| InChIKey | ATDCMNOSKUEFOF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol?
The IUPAC name of 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol (CID 17271274) is 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol.
What is the SMILES notation for 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol?
The canonical SMILES for 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol is Cc1cc(C)c2nc(NCc3ccccc3O)sc2c1.
What is the InChIKey of 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol?
The InChIKey is ATDCMNOSKUEFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2OS/c1-10-7-11(2)15-14(8-10)20-16(18-15)17-9-12-5-3-4-6-13(12)19/h3-8,19H,9H2,1-2H3,(H,17,18).
What are the key properties of 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol?
2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol has a molecular weight of 284.38 g/mol, XLogP of 4.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]methyl]phenol is sourced from PubChem (CID 17271274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).