About 2-phenylindole-4,6-diimine
2-phenylindole-4,6-diimine (PubChem CID 172713172) has the molecular formula C14H11N3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-phenylindole-4,6-diimine.
Molecular Properties
| Compound Name | 2-phenylindole-4,6-diimine |
| PubChem CID | 172713172 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-phenylindole-4,6-diimine |
| SMILES | [H]/N=C1\C=C2N=C(c3ccccc3)C=C2/C(=N/[H])C1 |
| InChI | InChI=1S/C14H11N3/c15-10-6-12(16)11-8-13(17-14(11)7-10)9-4-2-1-3-5-9/h1-5,7-8,15-16H,6H2/b15-10-,16-12+ |
| InChIKey | FMZPOFLCKWIBEH-RWIOWDNPSA-N |
| XLogP | 2.74 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylindole-4,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylindole-4,6-diimine?
The IUPAC name of 2-phenylindole-4,6-diimine (CID 172713172) is 2-phenylindole-4,6-diimine.
What is the SMILES notation for 2-phenylindole-4,6-diimine?
The canonical SMILES for 2-phenylindole-4,6-diimine is [H]/N=C1\C=C2N=C(c3ccccc3)C=C2/C(=N/[H])C1.
What is the InChIKey of 2-phenylindole-4,6-diimine?
The InChIKey is FMZPOFLCKWIBEH-RWIOWDNPSA-N. The full InChI is InChI=1S/C14H11N3/c15-10-6-12(16)11-8-13(17-14(11)7-10)9-4-2-1-3-5-9/h1-5,7-8,15-16H,6H2/b15-10-,16-12+.
What are the key properties of 2-phenylindole-4,6-diimine?
2-phenylindole-4,6-diimine has a molecular weight of 221.26 g/mol, XLogP of 2.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylindole-4,6-diimine is sourced from PubChem (CID 172713172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).