C40H54N6O7 — CID 172713293
12-[4-[[4-[[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-methylamino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]oxymethyl]-2,6-dimethylphenoxy]-3,11-dimethyl-12-oxododecanoic acid (PubChem CID 172713293) has the molecular formula C40H54N6O7 and a molecular weight of 730.91 g/mol. Its IUPAC name is 12-[4-[[4-[[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-methylamino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]oxymethyl]-2,6-dimethylphenoxy]-3,11-dimethyl-12-oxododecanoic acid.
| Compound Name | 12-[4-[[4-[[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-methylamino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]oxymethyl]-2,6-dimethylphenoxy]-3,11-dimethyl-12-oxododecanoic acid |
|---|---|
| PubChem CID | 172713293 |
| Molecular Formula | C40H54N6O7 |
| Molecular Weight | 730.91 g/mol |
| Exact Mass | 730.41 |
| IUPAC Name | 12-[4-[[4-[[(3R,4R)-1-(2-cyanoacetyl)-4-methylpiperidin-3-yl]-methylamino]pyrrolo[2,3-d]pyrimidine-7-carbonyl]oxymethyl]-2,6-dimethylphenoxy]-3,11-dimethyl-12-oxododecanoic acid |
| SMILES | Cc1cc(COC(=O)n2ccc3c(N(C)[C@H]4CN(C(=O)CC#N)CC[C@H]4C)ncnc32)cc(C)c1OC(=O)C(C)CCCCCCCC(C)CC(=O)O |
| InChI | InChI=1S/C40H54N6O7/c1-26(20-35(48)49)12-10-8-7-9-11-13-28(3)39(50)53-36-29(4)21-31(22-30(36)5)24-52-40(51)46-19-16-32-37(42-25-43-38(32)46)44(6)33-23-45(18-15-27(33)2)34(47)14-17-41/h16,19,21-22,25-28,33H,7-15,18,20,23-24H2,1-6H3,(H,48,49)/t26?,27-,28?,33+/m1/s1 |
| InChIKey | FNKILXCWILFVSN-ZQXGNRCISA-N |
| XLogP | 7.20 |
| TPSA | 167.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.91 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|