C33H46O6 — CID 172713397
(3aR,4R,5R,6aS)-5-[(4-methoxyphenyl)methoxy]-4-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 172713397) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-[(4-methoxyphenyl)methoxy]-4-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-5-[(4-methoxyphenyl)methoxy]-4-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 172713397 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-[(4-methoxyphenyl)methoxy]-4-[(E,3S,5S)-3-[(4-methoxyphenyl)methoxy]-5-methylnon-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OCc1ccc(OC)cc1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H46O6/c1-5-6-7-23(2)18-28(37-21-24-8-12-26(35-3)13-9-24)16-17-29-30-19-33(34)39-32(30)20-31(29)38-22-25-10-14-27(36-4)15-11-25/h8-17,23,28-34H,5-7,18-22H2,1-4H3/b17-16+/t23-,28+,29+,30+,31+,32-,33?/m0/s1 |
| InChIKey | FNSFOFFQKAQBNC-WCGASYRISA-N |
| XLogP | 6.69 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|