C10H14N2O — CID 172713565
3-amino-1,3,4,5,5a,6-hexahydro-1-benzazepin-2-one (PubChem CID 172713565) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is 3-amino-1,3,4,5,5a,6-hexahydro-1-benzazepin-2-one.
| Compound Name | 3-amino-1,3,4,5,5a,6-hexahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 172713565 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-amino-1,3,4,5,5a,6-hexahydro-1-benzazepin-2-one |
| SMILES | NC1CCC2CC=CC=C2NC1=O |
| InChI | InChI=1S/C10H14N2O/c11-8-6-5-7-3-1-2-4-9(7)12-10(8)13/h1-2,4,7-8H,3,5-6,11H2,(H,12,13) |
| InChIKey | FOHHETVVJLQPPA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |