C22H52N2O4Si2 — CID 172714286
N,N'-bis(3-dimethoxysilylbutyl)-N,N'-dimethyloctane-1,8-diamine (PubChem CID 172714286) has the molecular formula C22H52N2O4Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is N,N'-bis(3-dimethoxysilylbutyl)-N,N'-dimethyloctane-1,8-diamine.
| Compound Name | N,N'-bis(3-dimethoxysilylbutyl)-N,N'-dimethyloctane-1,8-diamine |
|---|---|
| PubChem CID | 172714286 |
| Molecular Formula | C22H52N2O4Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | N,N'-bis(3-dimethoxysilylbutyl)-N,N'-dimethyloctane-1,8-diamine |
| SMILES | CO[SiH](OC)C(C)CCN(C)CCCCCCCCN(C)CCC(C)[SiH](OC)OC |
| InChI | InChI=1S/C22H52N2O4Si2/c1-21(29(25-5)26-6)15-19-23(3)17-13-11-9-10-12-14-18-24(4)20-16-22(2)30(27-7)28-8/h21-22,29-30H,9-20H2,1-8H3 |
| InChIKey | FQRMUYQGCMALRM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|