C31H32F5NO3S — CID 172714840
6-[4-(benzylsulfonylmethyl)phenyl]-1'-(3,3,4,4,4-pentafluorobutyl)spiro[3,4-dihydrochromene-2,4'-piperidine] (PubChem CID 172714840) has the molecular formula C31H32F5NO3S and a molecular weight of 593.66 g/mol. Its IUPAC name is 6-[4-(benzylsulfonylmethyl)phenyl]-1'-(3,3,4,4,4-pentafluorobutyl)spiro[3,4-dihydrochromene-2,4'-piperidine].
| Compound Name | 6-[4-(benzylsulfonylmethyl)phenyl]-1'-(3,3,4,4,4-pentafluorobutyl)spiro[3,4-dihydrochromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 172714840 |
| Molecular Formula | C31H32F5NO3S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 6-[4-(benzylsulfonylmethyl)phenyl]-1'-(3,3,4,4,4-pentafluorobutyl)spiro[3,4-dihydrochromene-2,4'-piperidine] |
| SMILES | O=S(=O)(Cc1ccccc1)Cc1ccc(-c2ccc3c(c2)CCC2(CCN(CCC(F)(F)C(F)(F)F)CC2)O3)cc1 |
| InChI | InChI=1S/C31H32F5NO3S/c32-30(33,31(34,35)36)16-19-37-17-14-29(15-18-37)13-12-27-20-26(10-11-28(27)40-29)25-8-6-24(7-9-25)22-41(38,39)21-23-4-2-1-3-5-23/h1-11,20H,12-19,21-22H2 |
| InChIKey | FSNFMUFPZGBTMM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|