C14HF19O2 — CID 172715045
2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(2,3,4,5,6-pentafluorophenyl)octanoic acid (PubChem CID 172715045) has the molecular formula C14HF19O2 and a molecular weight of 562.12 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(2,3,4,5,6-pentafluorophenyl)octanoic acid.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(2,3,4,5,6-pentafluorophenyl)octanoic acid |
|---|---|
| PubChem CID | 172715045 |
| Molecular Formula | C14HF19O2 |
| Molecular Weight | 562.12 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluoro-2-(2,3,4,5,6-pentafluorophenyl)octanoic acid |
| SMILES | O=C(O)C(F)(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14HF19O2/c15-2-1(3(16)5(18)6(19)4(2)17)8(20,7(34)35)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)33/h(H,34,35) |
| InChIKey | FTCODRVSEFVYJV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.12 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|