C8H4N4 — CID 172715309
3,4,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,5,7,9,11-hexaene (PubChem CID 172715309) has the molecular formula C8H4N4 and a molecular weight of 156.15 g/mol. Its IUPAC name is 3,4,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,5,7,9,11-hexaene.
| Compound Name | 3,4,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 172715309 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3,4,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,3,5,7,9,11-hexaene |
| SMILES | C1=C2N=c3cccnc3=C2N=N1 |
| InChI | InChI=1S/C8H4N4/c1-2-5-7(9-3-1)8-6(11-5)4-10-12-8/h1-4H |
| InChIKey | FTZWVBNMULVVBX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |