C28H36O6 — CID 172715824
2,4-bis[2-butoxy-4-(2-hydroxyethyl)phenyl]cyclobuta-1,3-diene-1,3-diol (PubChem CID 172715824) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2,4-bis[2-butoxy-4-(2-hydroxyethyl)phenyl]cyclobuta-1,3-diene-1,3-diol.
| Compound Name | 2,4-bis[2-butoxy-4-(2-hydroxyethyl)phenyl]cyclobuta-1,3-diene-1,3-diol |
|---|---|
| PubChem CID | 172715824 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2,4-bis[2-butoxy-4-(2-hydroxyethyl)phenyl]cyclobuta-1,3-diene-1,3-diol |
| SMILES | CCCCOc1cc(CCO)ccc1C1=C(O)C(c2ccc(CCO)cc2OCCCC)=C1O |
| InChI | InChI=1S/C28H36O6/c1-3-5-15-33-23-17-19(11-13-29)7-9-21(23)25-27(31)26(28(25)32)22-10-8-20(12-14-30)18-24(22)34-16-6-4-2/h7-10,17-18,29-32H,3-6,11-16H2,1-2H3 |
| InChIKey | FVTNEOSRUASWDM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|