About N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline
N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline (PubChem CID 172716107) has the molecular formula C17H18F2N2
and a molecular weight of 288.34 g/mol. Its IUPAC name is N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline.
Molecular Properties
| Compound Name | N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline |
| PubChem CID | 172716107 |
| Molecular Formula | C17H18F2N2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline |
| SMILES | CC(C)(C)N(N=Cc1cccc(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C17H18F2N2/c1-17(2,3)21(14-9-5-4-6-10-14)20-12-13-8-7-11-15(18)16(13)19/h4-12H,1-3H3 |
| InChIKey | FWPLRNDFXPBFQL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline?
The IUPAC name of N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline (CID 172716107) is N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline.
What is the SMILES notation for N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline?
The canonical SMILES for N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline is CC(C)(C)N(N=Cc1cccc(F)c1F)c1ccccc1.
What is the InChIKey of N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline?
The InChIKey is FWPLRNDFXPBFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2/c1-17(2,3)21(14-9-5-4-6-10-14)20-12-13-8-7-11-15(18)16(13)19/h4-12H,1-3H3.
What are the key properties of N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline?
N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline has a molecular weight of 288.34 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-[(2,3-difluorophenyl)methylideneamino]aniline is sourced from PubChem (CID 172716107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).