C23H39N3O6 — CID 172716328
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[3-methoxy-5-(1,2-oxazolidin-2-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol (PubChem CID 172716328) has the molecular formula C23H39N3O6 and a molecular weight of 453.58 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[3-methoxy-5-(1,2-oxazolidin-2-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[3-methoxy-5-(1,2-oxazolidin-2-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 172716328 |
| Molecular Formula | C23H39N3O6 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-[3-methoxy-5-(1,2-oxazolidin-2-ylmethyl)anilino]hexyl]piperidine-3,4,5-triol |
| SMILES | COc1cc(CN2CCCO2)cc(NCCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c1 |
| InChI | InChI=1S/C23H39N3O6/c1-31-19-12-17(14-26-9-6-10-32-26)11-18(13-19)24-7-4-2-3-5-8-25-15-21(28)23(30)22(29)20(25)16-27/h11-13,20-24,27-30H,2-10,14-16H2,1H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | FXHHJVNHZMCRNV-KAOXLYBCSA-N |
| XLogP | 0.56 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|