About CID 172716670
CID 172716670 (PubChem CID 172716670) has the molecular formula C5H9NNaO2
and a molecular weight of 138.12 g/mol.
Molecular Properties
| Compound Name | CID 172716670 |
| PubChem CID | 172716670 |
| Molecular Formula | C5H9NNaO2 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | — |
| SMILES | COC(CC#N)OC.[Na] |
| InChI | InChI=1S/C5H9NO2.Na/c1-7-5(8-2)3-4-6;/h5H,3H2,1-2H3; |
| InChIKey | FYJZWOFQXXCLAX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 172716670 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172716670?
The IUPAC name of CID 172716670 (CID 172716670) is not available.
What is the SMILES notation for CID 172716670?
The canonical SMILES for CID 172716670 is COC(CC#N)OC.[Na].
What is the InChIKey of CID 172716670?
The InChIKey is FYJZWOFQXXCLAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.Na/c1-7-5(8-2)3-4-6;/h5H,3H2,1-2H3;.
What are the key properties of CID 172716670?
CID 172716670 has a molecular weight of 138.12 g/mol, XLogP of 0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172716670 is sourced from PubChem (CID 172716670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).