About 2-[4-aminobutyl(methyl)amino]acetic acid;azane
2-[4-aminobutyl(methyl)amino]acetic acid;azane (PubChem CID 172717710) has the molecular formula C7H19N3O2
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-[4-aminobutyl(methyl)amino]acetic acid;azane.
Molecular Properties
| Compound Name | 2-[4-aminobutyl(methyl)amino]acetic acid;azane |
| PubChem CID | 172717710 |
| Molecular Formula | C7H19N3O2 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-[4-aminobutyl(methyl)amino]acetic acid;azane |
| SMILES | CN(CCCCN)CC(=O)O.N |
| InChI | InChI=1S/C7H16N2O2.H3N/c1-9(6-7(10)11)5-3-2-4-8;/h2-6,8H2,1H3,(H,10,11);1H3 |
| InChIKey | GBZKBFXZQGSRAL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-aminobutyl(methyl)amino]acetic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-aminobutyl(methyl)amino]acetic acid;azane?
The IUPAC name of 2-[4-aminobutyl(methyl)amino]acetic acid;azane (CID 172717710) is 2-[4-aminobutyl(methyl)amino]acetic acid;azane.
What is the SMILES notation for 2-[4-aminobutyl(methyl)amino]acetic acid;azane?
The canonical SMILES for 2-[4-aminobutyl(methyl)amino]acetic acid;azane is CN(CCCCN)CC(=O)O.N.
What is the InChIKey of 2-[4-aminobutyl(methyl)amino]acetic acid;azane?
The InChIKey is GBZKBFXZQGSRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2.H3N/c1-9(6-7(10)11)5-3-2-4-8;/h2-6,8H2,1H3,(H,10,11);1H3.
What are the key properties of 2-[4-aminobutyl(methyl)amino]acetic acid;azane?
2-[4-aminobutyl(methyl)amino]acetic acid;azane has a molecular weight of 177.25 g/mol, XLogP of -0.10, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-aminobutyl(methyl)amino]acetic acid;azane is sourced from PubChem (CID 172717710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).