About [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate
[3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate (PubChem CID 172718265) has the molecular formula C12H9F2N3O3
and a molecular weight of 281.22 g/mol. Its IUPAC name is [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate |
| PubChem CID | 172718265 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate |
| SMILES | O=C(OCc1ncccc1OC(F)F)c1cnccn1 |
| InChI | InChI=1S/C12H9F2N3O3/c13-12(14)20-10-2-1-3-16-9(10)7-19-11(18)8-6-15-4-5-17-8/h1-6,12H,7H2 |
| InChIKey | GDQOMIOPRPZHCL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate?
The IUPAC name of [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate (CID 172718265) is [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate.
What is the SMILES notation for [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate?
The canonical SMILES for [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate is O=C(OCc1ncccc1OC(F)F)c1cnccn1.
What is the InChIKey of [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate?
The InChIKey is GDQOMIOPRPZHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N3O3/c13-12(14)20-10-2-1-3-16-9(10)7-19-11(18)8-6-15-4-5-17-8/h1-6,12H,7H2.
What are the key properties of [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate?
[3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate has a molecular weight of 281.22 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(difluoromethoxy)-2-pyridinyl]methyl pyrazine-2-carboxylate is sourced from PubChem (CID 172718265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).