About calcium;dioxido(dioxo)chromium;sulfuric acid
calcium;dioxido(dioxo)chromium;sulfuric acid (PubChem CID 172718284) has the molecular formula H2CaCrO8S
and a molecular weight of 254.15 g/mol. Its IUPAC name is calcium;dioxido(dioxo)chromium;sulfuric acid.
Molecular Properties
| Compound Name | calcium;dioxido(dioxo)chromium;sulfuric acid |
| PubChem CID | 172718284 |
| Molecular Formula | H2CaCrO8S |
| Molecular Weight | 254.15 g/mol |
| Exact Mass | 253.85 |
| IUPAC Name | calcium;dioxido(dioxo)chromium;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[Cr](=O)([O-])[O-].[Ca+2] |
| InChI | InChI=1S/Ca.Cr.H2O4S.4O/c;;1-5(2,3)4;;;;/h;;(H2,1,2,3,4);;;;/q+2;;;;;2*-1 |
| InChIKey | GDSLISJGIDNGJT-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.15 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze calcium;dioxido(dioxo)chromium;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dioxido(dioxo)chromium;sulfuric acid?
The IUPAC name of calcium;dioxido(dioxo)chromium;sulfuric acid (CID 172718284) is calcium;dioxido(dioxo)chromium;sulfuric acid.
What is the SMILES notation for calcium;dioxido(dioxo)chromium;sulfuric acid?
The canonical SMILES for calcium;dioxido(dioxo)chromium;sulfuric acid is O=S(=O)(O)O.O=[Cr](=O)([O-])[O-].[Ca+2].
What is the InChIKey of calcium;dioxido(dioxo)chromium;sulfuric acid?
The InChIKey is GDSLISJGIDNGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/Ca.Cr.H2O4S.4O/c;;1-5(2,3)4;;;;/h;;(H2,1,2,3,4);;;;/q+2;;;;;2*-1.
What are the key properties of calcium;dioxido(dioxo)chromium;sulfuric acid?
calcium;dioxido(dioxo)chromium;sulfuric acid has a molecular weight of 254.15 g/mol, XLogP of -3.65, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dioxido(dioxo)chromium;sulfuric acid is sourced from PubChem (CID 172718284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).