C58H116N6O2 — CID 172719454
N,N'-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 172719454) has the molecular formula C58H116N6O2 and a molecular weight of 929.61 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 172719454 |
| Molecular Formula | C58H116N6O2 |
| Molecular Weight | 929.61 g/mol |
| Exact Mass | 928.92 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CCCCCCCCON1C(C)(C)CCC(N(CCCCCCN(C2CC(C)(C)NC(C)(C)C2)C2CCC(C)(C)N(OCCCCCCCC)C2(C)C)C2CC(C)(C)NC(C)(C)C2)C1(C)C |
| InChI | InChI=1S/C58H116N6O2/c1-19-21-23-25-29-33-41-65-63-55(11,12)37-35-49(57(63,15)16)61(47-43-51(3,4)59-52(5,6)44-47)39-31-27-28-32-40-62(48-45-53(7,8)60-54(9,10)46-48)50-36-38-56(13,14)64(58(50,17)18)66-42-34-30-26-24-22-20-2/h47-50,59-60H,19-46H2,1-18H3 |
| InChIKey | GHQYTXIHZGNENB-UHFFFAOYSA-N |
| XLogP | 14.40 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.61 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|