C30H41N5O2 — CID 172720851
4'-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-2'-[[(2S)-1-propan-2-ylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-6,8-dihydro-5H-quinazoline]-5-ol (PubChem CID 172720851) has the molecular formula C30H41N5O2 and a molecular weight of 503.69 g/mol. Its IUPAC name is 4'-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-2'-[[(2S)-1-propan-2-ylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-6,8-dihydro-5H-quinazoline]-5-ol.
| Compound Name | 4'-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-2'-[[(2S)-1-propan-2-ylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-6,8-dihydro-5H-quinazoline]-5-ol |
|---|---|
| PubChem CID | 172720851 |
| Molecular Formula | C30H41N5O2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | 4'-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-2'-[[(2S)-1-propan-2-ylpyrrolidin-2-yl]methoxy]spiro[1,2-dihydroindene-3,7'-6,8-dihydro-5H-quinazoline]-5-ol |
| SMILES | CC(C)N1CCC[C@H]1COc1nc2c(c(N3[C@@H]4CC[C@H]3CNC4)n1)CCC1(CCc3ccc(O)cc31)C2 |
| InChI | InChI=1S/C30H41N5O2/c1-19(2)34-13-3-4-23(34)18-37-29-32-27-15-30(11-9-20-5-8-24(36)14-26(20)30)12-10-25(27)28(33-29)35-21-6-7-22(35)17-31-16-21/h5,8,14,19,21-23,31,36H,3-4,6-7,9-13,15-18H2,1-2H3/t21-,22+,23-,30?/m0/s1 |
| InChIKey | GMNWBJQSKHESMR-ZCEVVRMQSA-N |
| XLogP | 3.75 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |