C23H39NO4Si — CID 172721055
3-[(R)-3-ethoxypropoxy(phenyl)methyl]-2-(2-trimethylsilylethyl)piperidine-1-carboxylic acid (PubChem CID 172721055) has the molecular formula C23H39NO4Si and a molecular weight of 421.65 g/mol. Its IUPAC name is 3-[(R)-3-ethoxypropoxy(phenyl)methyl]-2-(2-trimethylsilylethyl)piperidine-1-carboxylic acid.
| Compound Name | 3-[(R)-3-ethoxypropoxy(phenyl)methyl]-2-(2-trimethylsilylethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 172721055 |
| Molecular Formula | C23H39NO4Si |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 3-[(R)-3-ethoxypropoxy(phenyl)methyl]-2-(2-trimethylsilylethyl)piperidine-1-carboxylic acid |
| SMILES | CCOCCCO[C@@H](c1ccccc1)C1CCCN(C(=O)O)C1CC[Si](C)(C)C |
| InChI | InChI=1S/C23H39NO4Si/c1-5-27-16-10-17-28-22(19-11-7-6-8-12-19)20-13-9-15-24(23(25)26)21(20)14-18-29(2,3)4/h6-8,11-12,20-22H,5,9-10,13-18H2,1-4H3,(H,25,26)/t20?,21?,22-/m0/s1 |
| InChIKey | GNBSURIGWFQRKK-HRTMPFAESA-N |
| XLogP | 5.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|