C28H16F6N6O3S — CID 172721108
1-[3-(1-benzofuran-7-yl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 172721108) has the molecular formula C28H16F6N6O3S and a molecular weight of 630.53 g/mol. Its IUPAC name is 1-[3-(1-benzofuran-7-yl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[3-(1-benzofuran-7-yl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 172721108 |
| Molecular Formula | C28H16F6N6O3S |
| Molecular Weight | 630.53 g/mol |
| Exact Mass | 630.09 |
| IUPAC Name | 1-[3-(1-benzofuran-7-yl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | O=C(N=C1SCC(=O)N1c1cccc2ccoc12)Nc1ccc(-c2ncn(-c3ccc(C(F)(F)C(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C28H16F6N6O3S/c29-19-12-16(24-35-14-39(38-24)18-7-5-17(6-8-18)27(30,31)28(32,33)34)4-9-20(19)36-25(42)37-26-40(22(41)13-44-26)21-3-1-2-15-10-11-43-23(15)21/h1-12,14H,13H2,(H,36,42) |
| InChIKey | GNGXLPXJHAPOFQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|