About 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine
3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine (PubChem CID 172722506) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine.
Molecular Properties
| Compound Name | 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine |
| PubChem CID | 172722506 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine |
| SMILES | Cn1cnc2c1C(N)C1(CCNCC1)C2 |
| InChI | InChI=1S/C11H18N4/c1-15-7-14-8-6-11(10(12)9(8)15)2-4-13-5-3-11/h7,10,13H,2-6,12H2,1H3 |
| InChIKey | GSAPWGHSZKHBJS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine?
The IUPAC name of 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine (CID 172722506) is 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine.
What is the SMILES notation for 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine?
The canonical SMILES for 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine is Cn1cnc2c1C(N)C1(CCNCC1)C2.
What is the InChIKey of 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine?
The InChIKey is GSAPWGHSZKHBJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c1-15-7-14-8-6-11(10(12)9(8)15)2-4-13-5-3-11/h7,10,13H,2-6,12H2,1H3.
What are the key properties of 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine?
3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine has a molecular weight of 206.29 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylspiro[4,6-dihydrocyclopenta[d]imidazole-5,4'-piperidine]-4-amine is sourced from PubChem (CID 172722506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).