C21H17N3O2 — CID 172723177
N-[3-[hydroxy(naphthalen-2-yl)methyl]phenyl]-1H-pyrazole-5-carboxamide (PubChem CID 172723177) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[3-[hydroxy(naphthalen-2-yl)methyl]phenyl]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-[hydroxy(naphthalen-2-yl)methyl]phenyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 172723177 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[3-[hydroxy(naphthalen-2-yl)methyl]phenyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(C(O)c2ccc3ccccc3c2)c1)c1ccn[nH]1 |
| InChI | InChI=1S/C21H17N3O2/c25-20(17-9-8-14-4-1-2-5-15(14)12-17)16-6-3-7-18(13-16)23-21(26)19-10-11-22-24-19/h1-13,20,25H,(H,22,24)(H,23,26) |
| InChIKey | GUGIGQAYKPBASV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |