C15H8ClF6N3O — CID 172723530
5-(5-chloro-3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine (PubChem CID 172723530) has the molecular formula C15H8ClF6N3O and a molecular weight of 395.69 g/mol. Its IUPAC name is 5-(5-chloro-3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine.
| Compound Name | 5-(5-chloro-3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 172723530 |
| Molecular Formula | C15H8ClF6N3O |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-(5-chloro-3-fluoro-1-oxidopyridin-1-ium-2-yl)-1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridine |
| SMILES | [O-][n+]1cc(Cl)cc(F)c1-c1cc2ccn(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C15H8ClF6N3O/c16-9-4-10(17)13(25(26)6-9)11-3-8-1-2-24(12(8)5-23-11)7-14(18,19)15(20,21)22/h1-6H,7H2 |
| InChIKey | GVKROPDKLQTTJL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|