About azane;2-nitro-1H-pyrrole
azane;2-nitro-1H-pyrrole (PubChem CID 172724090) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is azane;2-nitro-1H-pyrrole.
Molecular Properties
| Compound Name | azane;2-nitro-1H-pyrrole |
| PubChem CID | 172724090 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | azane;2-nitro-1H-pyrrole |
| SMILES | N.O=[N+]([O-])c1ccc[nH]1 |
| InChI | InChI=1S/C4H4N2O2.H3N/c7-6(8)4-2-1-3-5-4;/h1-3,5H;1H3 |
| InChIKey | MOPVIHTXVMVBRR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;2-nitro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-nitro-1H-pyrrole?
The IUPAC name of azane;2-nitro-1H-pyrrole (CID 172724090) is azane;2-nitro-1H-pyrrole.
What is the SMILES notation for azane;2-nitro-1H-pyrrole?
The canonical SMILES for azane;2-nitro-1H-pyrrole is N.O=[N+]([O-])c1ccc[nH]1.
What is the InChIKey of azane;2-nitro-1H-pyrrole?
The InChIKey is MOPVIHTXVMVBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.H3N/c7-6(8)4-2-1-3-5-4;/h1-3,5H;1H3.
What are the key properties of azane;2-nitro-1H-pyrrole?
azane;2-nitro-1H-pyrrole has a molecular weight of 129.12 g/mol, XLogP of 1.08, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-nitro-1H-pyrrole is sourced from PubChem (CID 172724090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).