C26H31ClF3N3O4 — CID 172724848
4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenol;2,2,2-trifluoroacetic acid (PubChem CID 172724848) has the molecular formula C26H31ClF3N3O4 and a molecular weight of 542.00 g/mol. Its IUPAC name is 4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenol;2,2,2-trifluoroacetic acid.
| Compound Name | 4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172724848 |
| Molecular Formula | C26H31ClF3N3O4 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenol;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(O)cc(-c2c(C)c(N3CCC4(CNC4)C3)nc3c2COC(C)(C)C3)c1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30ClN3O2.C2HF3O2/c1-14-7-16(29)8-17(21(14)25)20-15(2)22(28-6-5-24(13-28)11-26-12-24)27-19-9-23(3,4)30-10-18(19)20;3-2(4,5)1(6)7/h7-8,26,29H,5-6,9-13H2,1-4H3;(H,6,7) |
| InChIKey | GZUMAEAJXRDGLW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |