About 2,3-dibenzyl-1H-azepine
2,3-dibenzyl-1H-azepine (PubChem CID 172724902) has the molecular formula C20H19N
and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,3-dibenzyl-1H-azepine.
Molecular Properties
| Compound Name | 2,3-dibenzyl-1H-azepine |
| PubChem CID | 172724902 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2,3-dibenzyl-1H-azepine |
| SMILES | C1=CNC(Cc2ccccc2)=C(Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C20H19N/c1-3-9-17(10-4-1)15-19-13-7-8-14-21-20(19)16-18-11-5-2-6-12-18/h1-14,21H,15-16H2 |
| InChIKey | GZZVMYBTVUSMFU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dibenzyl-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibenzyl-1H-azepine?
The IUPAC name of 2,3-dibenzyl-1H-azepine (CID 172724902) is 2,3-dibenzyl-1H-azepine.
What is the SMILES notation for 2,3-dibenzyl-1H-azepine?
The canonical SMILES for 2,3-dibenzyl-1H-azepine is C1=CNC(Cc2ccccc2)=C(Cc2ccccc2)C=C1.
What is the InChIKey of 2,3-dibenzyl-1H-azepine?
The InChIKey is GZZVMYBTVUSMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N/c1-3-9-17(10-4-1)15-19-13-7-8-14-21-20(19)16-18-11-5-2-6-12-18/h1-14,21H,15-16H2.
What are the key properties of 2,3-dibenzyl-1H-azepine?
2,3-dibenzyl-1H-azepine has a molecular weight of 273.38 g/mol, XLogP of 4.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibenzyl-1H-azepine is sourced from PubChem (CID 172724902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).