C14H29F3O2Si — CID 172724919
ethoxy-ethyl-octyl-(2,2,2-trifluoroethoxy)silane (PubChem CID 172724919) has the molecular formula C14H29F3O2Si and a molecular weight of 314.46 g/mol. Its IUPAC name is ethoxy-ethyl-octyl-(2,2,2-trifluoroethoxy)silane.
| Compound Name | ethoxy-ethyl-octyl-(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 172724919 |
| Molecular Formula | C14H29F3O2Si |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethoxy-ethyl-octyl-(2,2,2-trifluoroethoxy)silane |
| SMILES | CCCCCCCC[Si](CC)(OCC)OCC(F)(F)F |
| InChI | InChI=1S/C14H29F3O2Si/c1-4-7-8-9-10-11-12-20(6-3,18-5-2)19-13-14(15,16)17/h4-13H2,1-3H3 |
| InChIKey | HABRMAAPJZMTGY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|