About 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one
2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 172727361) has the molecular formula C13H10ClNOS
and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one |
| PubChem CID | 172727361 |
| Molecular Formula | C13H10ClNOS |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2sc(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C13H10ClNOS/c14-9-3-1-8(2-4-9)12-7-10-11(17-12)5-6-15-13(10)16/h1-4,7H,5-6H2,(H,15,16) |
| InChIKey | HIBPSQBHLJPJOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one?
The IUPAC name of 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one (CID 172727361) is 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one.
What is the SMILES notation for 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one?
The canonical SMILES for 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one is O=C1NCCc2sc(-c3ccc(Cl)cc3)cc21.
What is the InChIKey of 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one?
The InChIKey is HIBPSQBHLJPJOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNOS/c14-9-3-1-8(2-4-9)12-7-10-11(17-12)5-6-15-13(10)16/h1-4,7H,5-6H2,(H,15,16).
What are the key properties of 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one?
2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one has a molecular weight of 263.75 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one is sourced from PubChem (CID 172727361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).