About tribromosilane;hydrochloride
tribromosilane;hydrochloride (PubChem CID 172727400) has the molecular formula H2Br3ClSi
and a molecular weight of 305.27 g/mol. Its IUPAC name is tribromosilane;hydrochloride.
Molecular Properties
| Compound Name | tribromosilane;hydrochloride |
| PubChem CID | 172727400 |
| Molecular Formula | H2Br3ClSi |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 301.72 |
| IUPAC Name | tribromosilane;hydrochloride |
| SMILES | Br[SiH](Br)Br.Cl |
| InChI | InChI=1S/Br3HSi.ClH/c1-4(2)3;/h4H;1H |
| InChIKey | JCBVHFGPOIUFEU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze tribromosilane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribromosilane;hydrochloride?
The IUPAC name of tribromosilane;hydrochloride (CID 172727400) is tribromosilane;hydrochloride.
What is the SMILES notation for tribromosilane;hydrochloride?
The canonical SMILES for tribromosilane;hydrochloride is Br[SiH](Br)Br.Cl.
What is the InChIKey of tribromosilane;hydrochloride?
The InChIKey is JCBVHFGPOIUFEU-UHFFFAOYSA-N. The full InChI is InChI=1S/Br3HSi.ClH/c1-4(2)3;/h4H;1H.
What are the key properties of tribromosilane;hydrochloride?
tribromosilane;hydrochloride has a molecular weight of 305.27 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tribromosilane;hydrochloride is sourced from PubChem (CID 172727400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).