sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane

C5F11Na — CID 172727471

IUPACsodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane
SMILESF[C-](F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+]
InChIInChI=1S/C5F11.Na/c6-1(7)2(8,9)3(10,11)4(12,13)5(14,15)16;/q-1;+1
InChIKeyIOZAFIDXLUEXAP-UHFFFAOYSA-N
MW292.02 g/mol
LogP0.89
Rot. Bonds3

About sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane

sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane (PubChem CID 172727471) has the molecular formula C5F11Na and a molecular weight of 292.02 g/mol. Its IUPAC name is sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane.

Molecular Properties

Compound Namesodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane
PubChem CID172727471
Molecular FormulaC5F11Na
Molecular Weight292.02 g/mol
Exact Mass291.97
IUPAC Namesodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane
SMILESF[C-](F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+]
InChIInChI=1S/C5F11.Na/c6-1(7)2(8,9)3(10,11)4(12,13)5(14,15)16;/q-1;+1
InChIKeyIOZAFIDXLUEXAP-UHFFFAOYSA-N
XLogP0.89
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.02
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane?
The IUPAC name of sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane (CID 172727471) is sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane.
What is the SMILES notation for sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane?
The canonical SMILES for sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane is F[C-](F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+].
What is the InChIKey of sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane?
The InChIKey is IOZAFIDXLUEXAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5F11.Na/c6-1(7)2(8,9)3(10,11)4(12,13)5(14,15)16;/q-1;+1.
What are the key properties of sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane?
sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane has a molecular weight of 292.02 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,1,1,2,2,3,3,4,4,5,5-undecafluoropentane is sourced from PubChem (CID 172727471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).