C21H20N2O6 — CID 17272756
butyl 2'-amino-7'-methyl-2,5'-dioxospiro[1H-indole-3,4'-pyrano[4,3-b]pyran]-3'-carboxylate (PubChem CID 17272756) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is butyl 2'-amino-7'-methyl-2,5'-dioxospiro[1H-indole-3,4'-pyrano[4,3-b]pyran]-3'-carboxylate.
| Compound Name | butyl 2'-amino-7'-methyl-2,5'-dioxospiro[1H-indole-3,4'-pyrano[4,3-b]pyran]-3'-carboxylate |
|---|---|
| PubChem CID | 17272756 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | butyl 2'-amino-7'-methyl-2,5'-dioxospiro[1H-indole-3,4'-pyrano[4,3-b]pyran]-3'-carboxylate |
| SMILES | CCCCOC(=O)C1=C(N)Oc2cc(C)oc(=O)c2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C21H20N2O6/c1-3-4-9-27-18(24)16-17(22)29-14-10-11(2)28-19(25)15(14)21(16)12-7-5-6-8-13(12)23-20(21)26/h5-8,10H,3-4,9,22H2,1-2H3,(H,23,26) |
| InChIKey | QHVOVYDZPFMLSF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|