About N,N-dipropylpropan-1-amine;isocyanic acid
N,N-dipropylpropan-1-amine;isocyanic acid (PubChem CID 172727710) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-dipropylpropan-1-amine;isocyanic acid.
Molecular Properties
| Compound Name | N,N-dipropylpropan-1-amine;isocyanic acid |
| PubChem CID | 172727710 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,N-dipropylpropan-1-amine;isocyanic acid |
| SMILES | CCCN(CCC)CCC.N=C=O |
| InChI | InChI=1S/C9H21N.CHNO/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;2H |
| InChIKey | HJFRSAOQLXPJRP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze N,N-dipropylpropan-1-amine;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropylpropan-1-amine;isocyanic acid?
The IUPAC name of N,N-dipropylpropan-1-amine;isocyanic acid (CID 172727710) is N,N-dipropylpropan-1-amine;isocyanic acid.
What is the SMILES notation for N,N-dipropylpropan-1-amine;isocyanic acid?
The canonical SMILES for N,N-dipropylpropan-1-amine;isocyanic acid is CCCN(CCC)CCC.N=C=O.
What is the InChIKey of N,N-dipropylpropan-1-amine;isocyanic acid?
The InChIKey is HJFRSAOQLXPJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.CHNO/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;2H.
What are the key properties of N,N-dipropylpropan-1-amine;isocyanic acid?
N,N-dipropylpropan-1-amine;isocyanic acid has a molecular weight of 186.30 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylpropan-1-amine;isocyanic acid is sourced from PubChem (CID 172727710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).