N,N-dipropylpropan-1-amine;isocyanic acid

C10H22N2O — CID 172727710

IUPACN,N-dipropylpropan-1-amine;isocyanic acid
SMILESCCCN(CCC)CCC.N=C=O
InChIInChI=1S/C9H21N.CHNO/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;2H
InChIKeyHJFRSAOQLXPJRP-UHFFFAOYSA-N
MW186.30 g/mol
LogP2.42
Rot. Bonds6

About N,N-dipropylpropan-1-amine;isocyanic acid

N,N-dipropylpropan-1-amine;isocyanic acid (PubChem CID 172727710) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-dipropylpropan-1-amine;isocyanic acid.

Molecular Properties

Compound NameN,N-dipropylpropan-1-amine;isocyanic acid
PubChem CID172727710
Molecular FormulaC10H22N2O
Molecular Weight186.30 g/mol
Exact Mass186.17
IUPAC NameN,N-dipropylpropan-1-amine;isocyanic acid
SMILESCCCN(CCC)CCC.N=C=O
InChIInChI=1S/C9H21N.CHNO/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;2H
InChIKeyHJFRSAOQLXPJRP-UHFFFAOYSA-N
XLogP2.42
TPSA44.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.30
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}

Analyze N,N-dipropylpropan-1-amine;isocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dipropylpropan-1-amine;isocyanic acid?
The IUPAC name of N,N-dipropylpropan-1-amine;isocyanic acid (CID 172727710) is N,N-dipropylpropan-1-amine;isocyanic acid.
What is the SMILES notation for N,N-dipropylpropan-1-amine;isocyanic acid?
The canonical SMILES for N,N-dipropylpropan-1-amine;isocyanic acid is CCCN(CCC)CCC.N=C=O.
What is the InChIKey of N,N-dipropylpropan-1-amine;isocyanic acid?
The InChIKey is HJFRSAOQLXPJRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.CHNO/c1-4-7-10(8-5-2)9-6-3;2-1-3/h4-9H2,1-3H3;2H.
What are the key properties of N,N-dipropylpropan-1-amine;isocyanic acid?
N,N-dipropylpropan-1-amine;isocyanic acid has a molecular weight of 186.30 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropylpropan-1-amine;isocyanic acid is sourced from PubChem (CID 172727710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).