C15H19N5O — CID 172728015
4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-trien-3-one (PubChem CID 172728015) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-trien-3-one.
| Compound Name | 4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-trien-3-one |
|---|---|
| PubChem CID | 172728015 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4,7,10,15,20-pentazapentacyclo[15.2.1.02,15.05,14.08,13]icosa-5,7,13-trien-3-one |
| SMILES | O=C1Nc2cnc3c(c2N2CC4CCC(N4)C12)CCNC3 |
| InChI | InChI=1S/C15H19N5O/c21-15-14-10-2-1-8(18-10)7-20(14)13-9-3-4-16-5-11(9)17-6-12(13)19-15/h6,8,10,14,16,18H,1-5,7H2,(H,19,21) |
| InChIKey | HKGIKKACIPTJQE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |