C22H23BrN4O2S — CID 172729704
2-[[6-[[5-(bromomethoxy)benzimidazol-1-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol (PubChem CID 172729704) has the molecular formula C22H23BrN4O2S and a molecular weight of 487.42 g/mol. Its IUPAC name is 2-[[6-[[5-(bromomethoxy)benzimidazol-1-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[6-[[5-(bromomethoxy)benzimidazol-1-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 172729704 |
| Molecular Formula | C22H23BrN4O2S |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[[6-[[5-(bromomethoxy)benzimidazol-1-yl]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCCCC1Nc1nc2ccc(Cn3cnc4cc(OCBr)ccc43)cc2s1 |
| InChI | InChI=1S/C22H23BrN4O2S/c23-12-29-15-6-8-19-18(10-15)24-13-27(19)11-14-5-7-17-21(9-14)30-22(26-17)25-16-3-1-2-4-20(16)28/h5-10,13,16,20,28H,1-4,11-12H2,(H,25,26) |
| InChIKey | HPYCKOHPQILBFN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|