About 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one
2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one (PubChem CID 172729743) has the molecular formula C15H10ClF2N3O2S
and a molecular weight of 369.78 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one |
| PubChem CID | 172729743 |
| Molecular Formula | C15H10ClF2N3O2S |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)F)nc(SCc2ncc(-c3ccccc3Cl)o2)[nH]1 |
| InChI | InChI=1S/C15H10ClF2N3O2S/c16-9-4-2-1-3-8(9)11-6-19-13(23-11)7-24-15-20-10(14(17)18)5-12(22)21-15/h1-6,14H,7H2,(H,20,21,22) |
| InChIKey | HQBITVOKXWOPCC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one?
The IUPAC name of 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one (CID 172729743) is 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one is O=c1cc(C(F)F)nc(SCc2ncc(-c3ccccc3Cl)o2)[nH]1.
What is the InChIKey of 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one?
The InChIKey is HQBITVOKXWOPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N3O2S/c16-9-4-2-1-3-8(9)11-6-19-13(23-11)7-24-15-20-10(14(17)18)5-12(22)21-15/h1-6,14H,7H2,(H,20,21,22).
What are the key properties of 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one?
2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one has a molecular weight of 369.78 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]-4-(difluoromethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 172729743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).