About carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride
carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride (PubChem CID 172729930) has the molecular formula C11H21ClN2O2
and a molecular weight of 248.75 g/mol. Its IUPAC name is carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride.
Molecular Properties
| Compound Name | carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride |
| PubChem CID | 172729930 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride |
| SMILES | C=CC(=O)[N+](C)(CCC(C)(C)C)C(N)=O.[Cl-] |
| InChI | InChI=1S/C11H20N2O2.ClH/c1-6-9(14)13(5,10(12)15)8-7-11(2,3)4;/h6H,1,7-8H2,2-5H3,(H-,12,15);1H |
| InChIKey | HQRGELRFJNKYDC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride?
The IUPAC name of carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride (CID 172729930) is carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride.
What is the SMILES notation for carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride?
The canonical SMILES for carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride is C=CC(=O)[N+](C)(CCC(C)(C)C)C(N)=O.[Cl-].
What is the InChIKey of carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride?
The InChIKey is HQRGELRFJNKYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2.ClH/c1-6-9(14)13(5,10(12)15)8-7-11(2,3)4;/h6H,1,7-8H2,2-5H3,(H-,12,15);1H.
What are the key properties of carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride?
carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride has a molecular weight of 248.75 g/mol, XLogP of -1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl-(3,3-dimethylbutyl)-methyl-prop-2-enoylazanium chloride is sourced from PubChem (CID 172729930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).