C2H5F3NaO4P — CID 172730635
sodium;phosphoric acid;1,1,1-trifluoroethane (PubChem CID 172730635) has the molecular formula C2H5F3NaO4P and a molecular weight of 204.02 g/mol. Its IUPAC name is sodium;phosphoric acid;1,1,1-trifluoroethane.
| Compound Name | sodium;phosphoric acid;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 172730635 |
| Molecular Formula | C2H5F3NaO4P |
| Molecular Weight | 204.02 g/mol |
| Exact Mass | 203.98 |
| IUPAC Name | sodium;phosphoric acid;1,1,1-trifluoroethane |
| SMILES | O=P(O)(O)O.[CH2-]C(F)(F)F.[Na+] |
| InChI | InChI=1S/C2H2F3.Na.H3O4P/c1-2(3,4)5;;1-5(2,3)4/h1H2;;(H3,1,2,3,4)/q-1;+1; |
| InChIKey | KOZWQQILIMPCPO-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.02 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|